C13H12N4O2 — CID 28600473
5-[(1-methylpyrazol-4-yl)methylamino]isoindole-1,3-dione (PubChem CID 28600473) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-[(1-methylpyrazol-4-yl)methylamino]isoindole-1,3-dione.
| Compound Name | 5-[(1-methylpyrazol-4-yl)methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 28600473 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-[(1-methylpyrazol-4-yl)methylamino]isoindole-1,3-dione |
| SMILES | Cn1cc(CNc2ccc3c(c2)C(=O)NC3=O)cn1 |
| InChI | InChI=1S/C13H12N4O2/c1-17-7-8(6-15-17)5-14-9-2-3-10-11(4-9)13(19)16-12(10)18/h2-4,6-7,14H,5H2,1H3,(H,16,18,19) |
| InChIKey | RNUKWQCNMIITMB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|