C14H14N4O2 — CID 103569190
5-[(1-ethylpyrazol-4-yl)methylamino]isoindole-1,3-dione (PubChem CID 103569190) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 5-[(1-ethylpyrazol-4-yl)methylamino]isoindole-1,3-dione.
| Compound Name | 5-[(1-ethylpyrazol-4-yl)methylamino]isoindole-1,3-dione |
|---|---|
| PubChem CID | 103569190 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 5-[(1-ethylpyrazol-4-yl)methylamino]isoindole-1,3-dione |
| SMILES | CCn1cc(CNc2ccc3c(c2)C(=O)NC3=O)cn1 |
| InChI | InChI=1S/C14H14N4O2/c1-2-18-8-9(7-16-18)6-15-10-3-4-11-12(5-10)14(20)17-13(11)19/h3-5,7-8,15H,2,6H2,1H3,(H,17,19,20) |
| InChIKey | UNUIFPPFCRPHQF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|