About 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one
5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one (PubChem CID 97401589) has the molecular formula C20H26N4O2
and a molecular weight of 354.45 g/mol. Its IUPAC name is 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one.
Molecular Properties
| Compound Name | 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one |
| PubChem CID | 97401589 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one |
| SMILES | CC(C)N1C(=O)C2(CCOCC2)c2cc(NCc3cnn(C)c3)ccc21 |
| InChI | InChI=1S/C20H26N4O2/c1-14(2)24-18-5-4-16(21-11-15-12-22-23(3)13-15)10-17(18)20(19(24)25)6-8-26-9-7-20/h4-5,10,12-14,21H,6-9,11H2,1-3H3 |
| InChIKey | ZQIYWCLQQXWHMX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one?
The IUPAC name of 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one (CID 97401589) is 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one.
What is the SMILES notation for 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one?
The canonical SMILES for 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one is CC(C)N1C(=O)C2(CCOCC2)c2cc(NCc3cnn(C)c3)ccc21.
What is the InChIKey of 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one?
The InChIKey is ZQIYWCLQQXWHMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N4O2/c1-14(2)24-18-5-4-16(21-11-15-12-22-23(3)13-15)10-17(18)20(19(24)25)6-8-26-9-7-20/h4-5,10,12-14,21H,6-9,11H2,1-3H3.
What are the key properties of 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one?
5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one has a molecular weight of 354.45 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-methylpyrazol-4-yl)methylamino]-1-propan-2-ylspiro[indole-3,4'-oxane]-2-one is sourced from PubChem (CID 97401589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).