About 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one
8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one (PubChem CID 167311008) has the molecular formula C13H10ClN3O
and a molecular weight of 259.70 g/mol. Its IUPAC name is 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one.
Molecular Properties
| Compound Name | 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one |
| PubChem CID | 167311008 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one |
| SMILES | CN1C(=O)C2(CC2)c2cc3cnnc(Cl)c3cc21 |
| InChI | InChI=1S/C13H10ClN3O/c1-17-10-5-8-7(6-15-16-11(8)14)4-9(10)13(2-3-13)12(17)18/h4-6H,2-3H2,1H3 |
| InChIKey | DWXGPQNHJQRELE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one?
The IUPAC name of 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one (CID 167311008) is 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one.
What is the SMILES notation for 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one?
The canonical SMILES for 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one is CN1C(=O)C2(CC2)c2cc3cnnc(Cl)c3cc21.
What is the InChIKey of 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one?
The InChIKey is DWXGPQNHJQRELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3O/c1-17-10-5-8-7(6-15-16-11(8)14)4-9(10)13(2-3-13)12(17)18/h4-6H,2-3H2,1H3.
What are the key properties of 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one?
8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one has a molecular weight of 259.70 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8'-chloro-1'-methylspiro[cyclopropane-1,3'-pyrrolo[3,2-g]phthalazine]-2'-one is sourced from PubChem (CID 167311008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).