C24H29ClN2O2 — CID 177346238
tert-butyl 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carboxylate (PubChem CID 177346238) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is tert-butyl 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 177346238 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | tert-butyl 6-anilino-6-(3-chloro-2-methylphenyl)-2-azaspiro[3.3]heptane-2-carboxylate |
| SMILES | Cc1c(Cl)cccc1C1(Nc2ccccc2)CC2(CN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C24H29ClN2O2/c1-17-19(11-8-12-20(17)25)24(26-18-9-6-5-7-10-18)13-23(14-24)15-27(16-23)21(28)29-22(2,3)4/h5-12,26H,13-16H2,1-4H3 |
| InChIKey | LGRPCMWHANJAOZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |