C19H27ClN2O2 — CID 177346345
tert-butyl 2-amino-2-(3-chloro-2-methylphenyl)-6-azaspiro[3.4]octane-6-carboxylate (PubChem CID 177346345) has the molecular formula C19H27ClN2O2 and a molecular weight of 350.89 g/mol. Its IUPAC name is tert-butyl 2-amino-2-(3-chloro-2-methylphenyl)-6-azaspiro[3.4]octane-6-carboxylate.
| Compound Name | tert-butyl 2-amino-2-(3-chloro-2-methylphenyl)-6-azaspiro[3.4]octane-6-carboxylate |
|---|---|
| PubChem CID | 177346345 |
| Molecular Formula | C19H27ClN2O2 |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | tert-butyl 2-amino-2-(3-chloro-2-methylphenyl)-6-azaspiro[3.4]octane-6-carboxylate |
| SMILES | Cc1c(Cl)cccc1C1(N)CC2(CCN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C19H27ClN2O2/c1-13-14(6-5-7-15(13)20)19(21)10-18(11-19)8-9-22(12-18)16(23)24-17(2,3)4/h5-7H,8-12,21H2,1-4H3 |
| InChIKey | PNXVKDGSOQHKBR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |