C23H23N2O — CID 143083725
CID 143083725 (PubChem CID 143083725) has the molecular formula C23H23N2O and a molecular weight of 343.45 g/mol.
| Compound Name | CID 143083725 |
|---|---|
| PubChem CID | 143083725 |
| Molecular Formula | C23H23N2O |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | — |
| SMILES | [CH2]c1ccc2c(C(=O)Nc3ccc4c(c3)N(C)CC4(C)C)cccc2c1 |
| InChI | InChI=1S/C23H23N2O/c1-15-8-10-18-16(12-15)6-5-7-19(18)22(26)24-17-9-11-20-21(13-17)25(4)14-23(20,2)3/h5-13H,1,14H2,2-4H3,(H,24,26) |
| InChIKey | JNIZKWJWELOVNT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |