C20H18N2O3 — CID 59310237
6-acetyl-N-[2-hydroxy-5-(methylamino)phenyl]naphthalene-1-carboxamide (PubChem CID 59310237) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is 6-acetyl-N-[2-hydroxy-5-(methylamino)phenyl]naphthalene-1-carboxamide.
| Compound Name | 6-acetyl-N-[2-hydroxy-5-(methylamino)phenyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 59310237 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-acetyl-N-[2-hydroxy-5-(methylamino)phenyl]naphthalene-1-carboxamide |
| SMILES | CNc1ccc(O)c(NC(=O)c2cccc3cc(C(C)=O)ccc23)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-12(23)13-6-8-16-14(10-13)4-3-5-17(16)20(25)22-18-11-15(21-2)7-9-19(18)24/h3-11,21,24H,1-2H3,(H,22,25) |
| InChIKey | ZVBKUKQOQLSTOY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|