C14H20ClFN4O — CID 67629598
4-amino-4-(3-chloro-4-fluoroanilino)-N,N-dimethylpiperidine-1-carboxamide (PubChem CID 67629598) has the molecular formula C14H20ClFN4O and a molecular weight of 314.79 g/mol. Its IUPAC name is 4-amino-4-(3-chloro-4-fluoroanilino)-N,N-dimethylpiperidine-1-carboxamide.
| Compound Name | 4-amino-4-(3-chloro-4-fluoroanilino)-N,N-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 67629598 |
| Molecular Formula | C14H20ClFN4O |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 4-amino-4-(3-chloro-4-fluoroanilino)-N,N-dimethylpiperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(N)(Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H20ClFN4O/c1-19(2)13(21)20-7-5-14(17,6-8-20)18-10-3-4-12(16)11(15)9-10/h3-4,9,18H,5-8,17H2,1-2H3 |
| InChIKey | SNXRZIWFNCNQCY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|