C13H17ClFN3O2 — CID 67629105
methyl 4-amino-4-(3-chloro-4-fluoroanilino)piperidine-1-carboxylate (PubChem CID 67629105) has the molecular formula C13H17ClFN3O2 and a molecular weight of 301.75 g/mol. Its IUPAC name is methyl 4-amino-4-(3-chloro-4-fluoroanilino)piperidine-1-carboxylate.
| Compound Name | methyl 4-amino-4-(3-chloro-4-fluoroanilino)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67629105 |
| Molecular Formula | C13H17ClFN3O2 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | methyl 4-amino-4-(3-chloro-4-fluoroanilino)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(N)(Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C13H17ClFN3O2/c1-20-12(19)18-6-4-13(16,5-7-18)17-9-2-3-11(15)10(14)8-9/h2-3,8,17H,4-7,16H2,1H3 |
| InChIKey | YIQVJVMHGYQCLT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|