C20H29ClFN3O — CID 174388279
[1-(3-chloro-4-fluoroanilino)cyclohexyl]-[4-(dimethylamino)piperidin-1-yl]methanone (PubChem CID 174388279) has the molecular formula C20H29ClFN3O and a molecular weight of 381.92 g/mol. Its IUPAC name is [1-(3-chloro-4-fluoroanilino)cyclohexyl]-[4-(dimethylamino)piperidin-1-yl]methanone.
| Compound Name | [1-(3-chloro-4-fluoroanilino)cyclohexyl]-[4-(dimethylamino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 174388279 |
| Molecular Formula | C20H29ClFN3O |
| Molecular Weight | 381.92 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | [1-(3-chloro-4-fluoroanilino)cyclohexyl]-[4-(dimethylamino)piperidin-1-yl]methanone |
| SMILES | CN(C)C1CCN(C(=O)C2(Nc3ccc(F)c(Cl)c3)CCCCC2)CC1 |
| InChI | InChI=1S/C20H29ClFN3O/c1-24(2)16-8-12-25(13-9-16)19(26)20(10-4-3-5-11-20)23-15-6-7-18(22)17(21)14-15/h6-7,14,16,23H,3-5,8-13H2,1-2H3 |
| InChIKey | UHNLXCNMSNXNDD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.92 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |