C18H26ClFN2 — CID 174369452
3-chloro-4-fluoro-N-[1-(piperidin-1-ylmethyl)cyclohexyl]aniline (PubChem CID 174369452) has the molecular formula C18H26ClFN2 and a molecular weight of 324.87 g/mol. Its IUPAC name is 3-chloro-4-fluoro-N-[1-(piperidin-1-ylmethyl)cyclohexyl]aniline.
| Compound Name | 3-chloro-4-fluoro-N-[1-(piperidin-1-ylmethyl)cyclohexyl]aniline |
|---|---|
| PubChem CID | 174369452 |
| Molecular Formula | C18H26ClFN2 |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | 3-chloro-4-fluoro-N-[1-(piperidin-1-ylmethyl)cyclohexyl]aniline |
| SMILES | Fc1ccc(NC2(CN3CCCCC3)CCCCC2)cc1Cl |
| InChI | InChI=1S/C18H26ClFN2/c19-16-13-15(7-8-17(16)20)21-18(9-3-1-4-10-18)14-22-11-5-2-6-12-22/h7-8,13,21H,1-6,9-12,14H2 |
| InChIKey | XWABGRMKMZTBPV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |