C14H14ClFN2O3 — CID 159674801
(3S)-N-(3-chloro-4-fluorophenyl)-1-(2-oxopropanoyl)pyrrolidine-3-carboxamide (PubChem CID 159674801) has the molecular formula C14H14ClFN2O3 and a molecular weight of 312.73 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-fluorophenyl)-1-(2-oxopropanoyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-(3-chloro-4-fluorophenyl)-1-(2-oxopropanoyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 159674801 |
| Molecular Formula | C14H14ClFN2O3 |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | (3S)-N-(3-chloro-4-fluorophenyl)-1-(2-oxopropanoyl)pyrrolidine-3-carboxamide |
| SMILES | CC(=O)C(=O)N1CC[C@H](C(=O)Nc2ccc(F)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H14ClFN2O3/c1-8(19)14(21)18-5-4-9(7-18)13(20)17-10-2-3-12(16)11(15)6-10/h2-3,6,9H,4-5,7H2,1H3,(H,17,20)/t9-/m0/s1 |
| InChIKey | KJVHNINTULMWSD-VIFPVBQESA-N |
| XLogP | 1.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|