C16H20FN3O2 — CID 172889531
3-(3-fluoro-2-methylphenyl)-1-methyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]urea (PubChem CID 172889531) has the molecular formula C16H20FN3O2 and a molecular weight of 305.35 g/mol. Its IUPAC name is 3-(3-fluoro-2-methylphenyl)-1-methyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]urea.
| Compound Name | 3-(3-fluoro-2-methylphenyl)-1-methyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 172889531 |
| Molecular Formula | C16H20FN3O2 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | 3-(3-fluoro-2-methylphenyl)-1-methyl-1-[(3S)-1-prop-2-enoylpyrrolidin-3-yl]urea |
| SMILES | C=CC(=O)N1CC[C@H](N(C)C(=O)Nc2cccc(F)c2C)C1 |
| InChI | InChI=1S/C16H20FN3O2/c1-4-15(21)20-9-8-12(10-20)19(3)16(22)18-14-7-5-6-13(17)11(14)2/h4-7,12H,1,8-10H2,2-3H3,(H,18,22)/t12-/m0/s1 |
| InChIKey | UPTWSVOEZVVYPK-LBPRGKRZSA-N |
| XLogP | 2.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|