C17H16F6N2O2 — CID 172888258
N-methyl-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 172888258) has the molecular formula C17H16F6N2O2 and a molecular weight of 394.32 g/mol. Its IUPAC name is N-methyl-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-methyl-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 172888258 |
| Molecular Formula | C17H16F6N2O2 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-methyl-N-[(3R)-1-prop-2-enoylpyrrolidin-3-yl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | C=CC(=O)N1CC[C@@H](N(C)C(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C17H16F6N2O2/c1-3-14(26)25-5-4-13(9-25)24(2)15(27)10-6-11(16(18,19)20)8-12(7-10)17(21,22)23/h3,6-8,13H,1,4-5,9H2,2H3/t13-/m1/s1 |
| InChIKey | FGJGUYHXVFCXBV-CYBMUJFWSA-N |
| XLogP | 3.58 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|