C21H23F2N3O2 — CID 20782216
1-(1-acetylpiperidin-4-yl)-3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methylurea (PubChem CID 20782216) has the molecular formula C21H23F2N3O2 and a molecular weight of 387.43 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methylurea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 20782216 |
| Molecular Formula | C21H23F2N3O2 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-[2-fluoro-4-(3-fluorophenyl)phenyl]-1-methylurea |
| SMILES | CC(=O)N1CCC(N(C)C(=O)Nc2ccc(-c3cccc(F)c3)cc2F)CC1 |
| InChI | InChI=1S/C21H23F2N3O2/c1-14(27)26-10-8-18(9-11-26)25(2)21(28)24-20-7-6-16(13-19(20)23)15-4-3-5-17(22)12-15/h3-7,12-13,18H,8-11H2,1-2H3,(H,24,28) |
| InChIKey | OATFPZPXAIVJEU-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |