C20H22FN3O2 — CID 20782434
3-[4-(3-fluorophenyl)phenyl]-1-(4-hydroxyiminocyclohexyl)-1-methylurea (PubChem CID 20782434) has the molecular formula C20H22FN3O2 and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-[4-(3-fluorophenyl)phenyl]-1-(4-hydroxyiminocyclohexyl)-1-methylurea.
| Compound Name | 3-[4-(3-fluorophenyl)phenyl]-1-(4-hydroxyiminocyclohexyl)-1-methylurea |
|---|---|
| PubChem CID | 20782434 |
| Molecular Formula | C20H22FN3O2 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 3-[4-(3-fluorophenyl)phenyl]-1-(4-hydroxyiminocyclohexyl)-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(-c2cccc(F)c2)cc1)C1CCC(=NO)CC1 |
| InChI | InChI=1S/C20H22FN3O2/c1-24(19-11-9-18(23-26)10-12-19)20(25)22-17-7-5-14(6-8-17)15-3-2-4-16(21)13-15/h2-8,13,19,26H,9-12H2,1H3,(H,22,25)/b23-18- |
| InChIKey | PSLDYEQHMLWTQO-NKFKGCMQSA-N |
| XLogP | 4.73 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|