C22H25F2N3O2 — CID 20782503
N-[4-[[4-(3,5-difluorophenyl)phenyl]carbamoyl-methylamino]cyclohexyl]acetamide (PubChem CID 20782503) has the molecular formula C22H25F2N3O2 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-[4-[[4-(3,5-difluorophenyl)phenyl]carbamoyl-methylamino]cyclohexyl]acetamide.
| Compound Name | N-[4-[[4-(3,5-difluorophenyl)phenyl]carbamoyl-methylamino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 20782503 |
| Molecular Formula | C22H25F2N3O2 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | N-[4-[[4-(3,5-difluorophenyl)phenyl]carbamoyl-methylamino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(N(C)C(=O)Nc2ccc(-c3cc(F)cc(F)c3)cc2)CC1 |
| InChI | InChI=1S/C22H25F2N3O2/c1-14(28)25-19-7-9-21(10-8-19)27(2)22(29)26-20-5-3-15(4-6-20)16-11-17(23)13-18(24)12-16/h3-6,11-13,19,21H,7-10H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | GHYHZQDUDUOVIL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |