C24H30N4O2 — CID 20782512
N-cyclopropyl-2-[4-[methyl-[(4-phenylphenyl)carbamoyl]amino]piperidin-1-yl]acetamide (PubChem CID 20782512) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-[methyl-[(4-phenylphenyl)carbamoyl]amino]piperidin-1-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[4-[methyl-[(4-phenylphenyl)carbamoyl]amino]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 20782512 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N-cyclopropyl-2-[4-[methyl-[(4-phenylphenyl)carbamoyl]amino]piperidin-1-yl]acetamide |
| SMILES | CN(C(=O)Nc1ccc(-c2ccccc2)cc1)C1CCN(CC(=O)NC2CC2)CC1 |
| InChI | InChI=1S/C24H30N4O2/c1-27(22-13-15-28(16-14-22)17-23(29)25-20-11-12-20)24(30)26-21-9-7-19(8-10-21)18-5-3-2-4-6-18/h2-10,20,22H,11-17H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | RRJOTOFLCCUFLF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |