C21H22F2N4O — CID 20782233
1-[1-(cyanomethyl)piperidin-4-yl]-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea (PubChem CID 20782233) has the molecular formula C21H22F2N4O and a molecular weight of 384.43 g/mol. Its IUPAC name is 1-[1-(cyanomethyl)piperidin-4-yl]-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea.
| Compound Name | 1-[1-(cyanomethyl)piperidin-4-yl]-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 20782233 |
| Molecular Formula | C21H22F2N4O |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 1-[1-(cyanomethyl)piperidin-4-yl]-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(-c2cc(F)cc(F)c2)cc1)C1CCN(CC#N)CC1 |
| InChI | InChI=1S/C21H22F2N4O/c1-26(20-6-9-27(10-7-20)11-8-24)21(28)25-19-4-2-15(3-5-19)16-12-17(22)14-18(23)13-16/h2-5,12-14,20H,6-7,9-11H2,1H3,(H,25,28) |
| InChIKey | CRLODTNOMNRHND-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|