C24H23F2N3O — CID 20782225
1-(1-benzylazetidin-3-yl)-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea (PubChem CID 20782225) has the molecular formula C24H23F2N3O and a molecular weight of 407.46 g/mol. Its IUPAC name is 1-(1-benzylazetidin-3-yl)-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea.
| Compound Name | 1-(1-benzylazetidin-3-yl)-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea |
|---|---|
| PubChem CID | 20782225 |
| Molecular Formula | C24H23F2N3O |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-(1-benzylazetidin-3-yl)-3-[4-(3,5-difluorophenyl)phenyl]-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(-c2cc(F)cc(F)c2)cc1)C1CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C24H23F2N3O/c1-28(23-15-29(16-23)14-17-5-3-2-4-6-17)24(30)27-22-9-7-18(8-10-22)19-11-20(25)13-21(26)12-19/h2-13,23H,14-16H2,1H3,(H,27,30) |
| InChIKey | IERZBYAFFQVBME-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |