C36H33F4N5O — CID 158600699
4-(3,5-difluorophenyl)aniline;3-[4-(3,5-difluorophenyl)phenyl]-1-methyl-1-(1-pyridin-3-ylpiperidin-4-yl)urea (PubChem CID 158600699) has the molecular formula C36H33F4N5O and a molecular weight of 627.69 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)aniline;3-[4-(3,5-difluorophenyl)phenyl]-1-methyl-1-(1-pyridin-3-ylpiperidin-4-yl)urea.
| Compound Name | 4-(3,5-difluorophenyl)aniline;3-[4-(3,5-difluorophenyl)phenyl]-1-methyl-1-(1-pyridin-3-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 158600699 |
| Molecular Formula | C36H33F4N5O |
| Molecular Weight | 627.69 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | 4-(3,5-difluorophenyl)aniline;3-[4-(3,5-difluorophenyl)phenyl]-1-methyl-1-(1-pyridin-3-ylpiperidin-4-yl)urea |
| SMILES | CN(C(=O)Nc1ccc(-c2cc(F)cc(F)c2)cc1)C1CCN(c2cccnc2)CC1.Nc1ccc(-c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C24H24F2N4O.C12H9F2N/c1-29(22-8-11-30(12-9-22)23-3-2-10-27-16-23)24(31)28-21-6-4-17(5-7-21)18-13-19(25)15-20(26)14-18;13-10-5-9(6-11(14)7-10)8-1-3-12(15)4-2-8/h2-7,10,13-16,22H,8-9,11-12H2,1H3,(H,28,31);1-7H,15H2 |
| InChIKey | HVPDVQRIQAYMKR-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.69 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|