C17H24IN3O — CID 20782245
1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-(4-iodophenyl)-1-methylurea (PubChem CID 20782245) has the molecular formula C17H24IN3O and a molecular weight of 413.30 g/mol. Its IUPAC name is 1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-(4-iodophenyl)-1-methylurea.
| Compound Name | 1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-(4-iodophenyl)-1-methylurea |
|---|---|
| PubChem CID | 20782245 |
| Molecular Formula | C17H24IN3O |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 1-[1-(cyclopropylmethyl)piperidin-4-yl]-3-(4-iodophenyl)-1-methylurea |
| SMILES | CN(C(=O)Nc1ccc(I)cc1)C1CCN(CC2CC2)CC1 |
| InChI | InChI=1S/C17H24IN3O/c1-20(17(22)19-15-6-4-14(18)5-7-15)16-8-10-21(11-9-16)12-13-2-3-13/h4-7,13,16H,2-3,8-12H2,1H3,(H,19,22) |
| InChIKey | ZEBIQTUSJLXJSF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|