C25H26F3N4OP — CID 142124765
3-[4-[3-[difluoro(phosphanyl)methyl]phenyl]-2-fluorophenyl]-1-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 142124765) has the molecular formula C25H26F3N4OP and a molecular weight of 486.48 g/mol. Its IUPAC name is 3-[4-[3-[difluoro(phosphanyl)methyl]phenyl]-2-fluorophenyl]-1-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 3-[4-[3-[difluoro(phosphanyl)methyl]phenyl]-2-fluorophenyl]-1-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 142124765 |
| Molecular Formula | C25H26F3N4OP |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-[4-[3-[difluoro(phosphanyl)methyl]phenyl]-2-fluorophenyl]-1-methyl-1-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | CN(C(=O)Nc1ccc(-c2cccc(C(F)(F)P)c2)cc1F)C1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C25H26F3N4OP/c1-31(20-10-13-32(14-11-20)23-7-2-3-12-29-23)24(33)30-22-9-8-18(16-21(22)26)17-5-4-6-19(15-17)25(27,28)34/h2-9,12,15-16,20H,10-11,13-14,34H2,1H3,(H,30,33) |
| InChIKey | BETWDWDCWKAFLF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|