C20H28F3N3O3 — CID 126711641
methyl 2-[1-butyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]piperidin-4-yl]acetate (PubChem CID 126711641) has the molecular formula C20H28F3N3O3 and a molecular weight of 415.46 g/mol. Its IUPAC name is methyl 2-[1-butyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-butyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 126711641 |
| Molecular Formula | C20H28F3N3O3 |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | methyl 2-[1-butyl-4-[[3-(trifluoromethyl)phenyl]carbamoylamino]piperidin-4-yl]acetate |
| SMILES | CCCCN1CCC(CC(=O)OC)(NC(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H28F3N3O3/c1-3-4-10-26-11-8-19(9-12-26,14-17(27)29-2)25-18(28)24-16-7-5-6-15(13-16)20(21,22)23/h5-7,13H,3-4,8-12,14H2,1-2H3,(H2,24,25,28) |
| InChIKey | PTAIRGJAEYWARP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |