C16H19F3N2O3S — CID 55567282
N-(1-cyclopropylpiperidin-4-yl)-4-(trifluoromethylsulfonyl)benzamide (PubChem CID 55567282) has the molecular formula C16H19F3N2O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is N-(1-cyclopropylpiperidin-4-yl)-4-(trifluoromethylsulfonyl)benzamide.
| Compound Name | N-(1-cyclopropylpiperidin-4-yl)-4-(trifluoromethylsulfonyl)benzamide |
|---|---|
| PubChem CID | 55567282 |
| Molecular Formula | C16H19F3N2O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N-(1-cyclopropylpiperidin-4-yl)-4-(trifluoromethylsulfonyl)benzamide |
| SMILES | O=C(NC1CCN(C2CC2)CC1)c1ccc(S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H19F3N2O3S/c17-16(18,19)25(23,24)14-5-1-11(2-6-14)15(22)20-12-7-9-21(10-8-12)13-3-4-13/h1-2,5-6,12-13H,3-4,7-10H2,(H,20,22) |
| InChIKey | YHAQZMIYMLHQLD-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |