C17H18F6N2O — CID 46548552
N-(1-cyclopropylpiperidin-4-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 46548552) has the molecular formula C17H18F6N2O and a molecular weight of 380.33 g/mol. Its IUPAC name is N-(1-cyclopropylpiperidin-4-yl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(1-cyclopropylpiperidin-4-yl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46548552 |
| Molecular Formula | C17H18F6N2O |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(1-cyclopropylpiperidin-4-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN(C2CC2)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F6N2O/c18-16(19,20)11-7-10(8-12(9-11)17(21,22)23)15(26)24-13-3-5-25(6-4-13)14-1-2-14/h7-9,13-14H,1-6H2,(H,24,26) |
| InChIKey | NVFUHRORCYSVFE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |