C36H34ClN5O2 — CID 146401500
N-(1-benzylpiperidin-4-yl)-3-[4-chloro-3-[4-methyl-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]benzamide (PubChem CID 146401500) has the molecular formula C36H34ClN5O2 and a molecular weight of 604.15 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-3-[4-chloro-3-[4-methyl-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]benzamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-3-[4-chloro-3-[4-methyl-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]benzamide |
|---|---|
| PubChem CID | 146401500 |
| Molecular Formula | C36H34ClN5O2 |
| Molecular Weight | 604.15 g/mol |
| Exact Mass | 603.24 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-3-[4-chloro-3-[4-methyl-3-(prop-2-enoylamino)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]benzamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3cccc(C(=O)NC4CCN(Cc5ccccc5)CC4)c3)[nH]c3nccc(Cl)c23)ccc1C |
| InChI | InChI=1S/C36H34ClN5O2/c1-3-31(43)40-30-21-25(13-12-23(30)2)32-33-29(37)14-17-38-35(33)41-34(32)26-10-7-11-27(20-26)36(44)39-28-15-18-42(19-16-28)22-24-8-5-4-6-9-24/h3-14,17,20-21,28H,1,15-16,18-19,22H2,2H3,(H,38,41)(H,39,44)(H,40,43) |
| InChIKey | CWHDDGRBAPZAKV-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.15 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|