C28H28ClN5O — CID 146401406
N-[5-[4-chloro-2-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 146401406) has the molecular formula C28H28ClN5O and a molecular weight of 486.02 g/mol. Its IUPAC name is N-[5-[4-chloro-2-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[4-chloro-2-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146401406 |
| Molecular Formula | C28H28ClN5O |
| Molecular Weight | 486.02 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[5-[4-chloro-2-[3-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3cccc(N4CCN(C)CC4)c3)[nH]c3nccc(Cl)c23)ccc1C |
| InChI | InChI=1S/C28H28ClN5O/c1-4-24(35)31-23-17-19(9-8-18(23)2)25-26-22(29)10-11-30-28(26)32-27(25)20-6-5-7-21(16-20)34-14-12-33(3)13-15-34/h4-11,16-17H,1,12-15H2,2-3H3,(H,30,32)(H,31,35) |
| InChIKey | YVMCQFMLWLGPJJ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.02 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|