C33H34ClN7O — CID 156759691
N-[5-[4-chloro-5-(1-ethylimidazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156759691) has the molecular formula C33H34ClN7O and a molecular weight of 580.14 g/mol. Its IUPAC name is N-[5-[4-chloro-5-(1-ethylimidazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[4-chloro-5-(1-ethylimidazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759691 |
| Molecular Formula | C33H34ClN7O |
| Molecular Weight | 580.14 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | N-[5-[4-chloro-5-(1-ethylimidazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(-c4cn(CC)cn4)c(Cl)c23)ccc1C |
| InChI | InChI=1S/C33H34ClN7O/c1-5-28(42)37-26-17-23(8-7-21(26)3)29-30-31(34)25(27-19-40(6-2)20-36-27)18-35-33(30)38-32(29)22-9-11-24(12-10-22)41-15-13-39(4)14-16-41/h5,7-12,17-20H,1,6,13-16H2,2-4H3,(H,35,38)(H,37,42) |
| InChIKey | IVVACEPSPMTOEE-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.14 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|