C33H34FN7O — CID 156759665
N-[5-[5-(1-ethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide (PubChem CID 156759665) has the molecular formula C33H34FN7O and a molecular weight of 563.68 g/mol. Its IUPAC name is N-[5-[5-(1-ethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[5-(1-ethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759665 |
| Molecular Formula | C33H34FN7O |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.28 |
| IUPAC Name | N-[5-[5-(1-ethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-3-fluoro-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(-c4cnn(CC)c4)cc23)cc(F)c1C |
| InChI | InChI=1S/C33H34FN7O/c1-5-30(42)37-29-17-23(16-28(34)21(29)3)31-27-15-24(25-19-36-41(6-2)20-25)18-35-33(27)38-32(31)22-7-9-26(10-8-22)40-13-11-39(4)12-14-40/h5,7-10,15-20H,1,6,11-14H2,2-4H3,(H,35,38)(H,37,42) |
| InChIKey | PWDZKFKVLAZJFF-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|