C34H37N7O — CID 156759755
N-[5-[2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156759755) has the molecular formula C34H37N7O and a molecular weight of 559.72 g/mol. Its IUPAC name is N-[5-[2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759755 |
| Molecular Formula | C34H37N7O |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | N-[5-[2-[4-[(3R)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)[C@H](C)C4)cc3)[nH]c3ncc(-c4cnn(CC)c4)cc23)ccc1C |
| InChI | InChI=1S/C34H37N7O/c1-6-31(42)37-30-17-25(9-8-22(30)3)32-29-16-26(27-19-36-41(7-2)21-27)18-35-34(29)38-33(32)24-10-12-28(13-11-24)40-15-14-39(5)23(4)20-40/h6,8-13,16-19,21,23H,1,7,14-15,20H2,2-5H3,(H,35,38)(H,37,42)/t23-/m1/s1 |
| InChIKey | BCFUCWCQYBRSLR-HSZRJFAPSA-N |
| XLogP | 6.35 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|