C27H28N6O — CID 146401353
N-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide (PubChem CID 146401353) has the molecular formula C27H28N6O and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide.
| Compound Name | N-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146401353 |
| Molecular Formula | C27H28N6O |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | N-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)CC4)nc3)[nH]c3ncccc23)ccc1C |
| InChI | InChI=1S/C27H28N6O/c1-4-24(34)30-22-16-19(8-7-18(22)2)25-21-6-5-11-28-27(21)31-26(25)20-9-10-23(29-17-20)33-14-12-32(3)13-15-33/h4-11,16-17H,1,12-15H2,2-3H3,(H,28,31)(H,30,34) |
| InChIKey | CXSFUAWQILPNTR-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|