C28H29N5O — CID 167574843
1-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]but-3-en-2-one (PubChem CID 167574843) has the molecular formula C28H29N5O and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 167574843 |
| Molecular Formula | C28H29N5O |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | 1-[2-methyl-5-[2-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(-c2c(-c3ccc(N4CCN(C)CC4)nc3)[nH]c3ncccc23)ccc1C |
| InChI | InChI=1S/C28H29N5O/c1-4-23(34)17-22-16-20(8-7-19(22)2)26-24-6-5-11-29-28(24)31-27(26)21-9-10-25(30-18-21)33-14-12-32(3)13-15-33/h4-11,16,18H,1,12-15,17H2,2-3H3,(H,29,31) |
| InChIKey | GJSBSTWAZKLCCL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|