C29H26ClN3O3 — CID 167690199
1-[5-[4-chloro-2-[4-(morpholine-4-carbonyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one (PubChem CID 167690199) has the molecular formula C29H26ClN3O3 and a molecular weight of 500.00 g/mol. Its IUPAC name is 1-[5-[4-chloro-2-[4-(morpholine-4-carbonyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one.
| Compound Name | 1-[5-[4-chloro-2-[4-(morpholine-4-carbonyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 167690199 |
| Molecular Formula | C29H26ClN3O3 |
| Molecular Weight | 500.00 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | 1-[5-[4-chloro-2-[4-(morpholine-4-carbonyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(-c2c(-c3ccc(C(=O)N4CCOCC4)cc3)[nH]c3nccc(Cl)c23)ccc1C |
| InChI | InChI=1S/C29H26ClN3O3/c1-3-23(34)17-22-16-21(5-4-18(22)2)25-26-24(30)10-11-31-28(26)32-27(25)19-6-8-20(9-7-19)29(35)33-12-14-36-15-13-33/h3-11,16H,1,12-15,17H2,2H3,(H,31,32) |
| InChIKey | WUVVRNUMLSDLSI-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.00 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|