C17H14ClIN4O2 — CID 25028462
[4-(6-chloro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-morpholin-4-ylmethanone (PubChem CID 25028462) has the molecular formula C17H14ClIN4O2 and a molecular weight of 468.68 g/mol. Its IUPAC name is [4-(6-chloro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(6-chloro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 25028462 |
| Molecular Formula | C17H14ClIN4O2 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | [4-(6-chloro-7-iodo-1H-imidazo[4,5-b]pyridin-2-yl)phenyl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(-c2nc3ncc(Cl)c(I)c3[nH]2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H14ClIN4O2/c18-12-9-20-16-14(13(12)19)21-15(22-16)10-1-3-11(4-2-10)17(24)23-5-7-25-8-6-23/h1-4,9H,5-8H2,(H,20,21,22) |
| InChIKey | ZEYCYSNSSFOCHR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|