C16H15Cl2N5O — CID 69373889
5-(6,7-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)-2-morpholin-4-ylaniline (PubChem CID 69373889) has the molecular formula C16H15Cl2N5O and a molecular weight of 364.24 g/mol. Its IUPAC name is 5-(6,7-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)-2-morpholin-4-ylaniline.
| Compound Name | 5-(6,7-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)-2-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 69373889 |
| Molecular Formula | C16H15Cl2N5O |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 5-(6,7-dichloro-1H-imidazo[4,5-b]pyridin-2-yl)-2-morpholin-4-ylaniline |
| SMILES | Nc1cc(-c2nc3ncc(Cl)c(Cl)c3[nH]2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C16H15Cl2N5O/c17-10-8-20-16-14(13(10)18)21-15(22-16)9-1-2-12(11(19)7-9)23-3-5-24-6-4-23/h1-2,7-8H,3-6,19H2,(H,20,21,22) |
| InChIKey | ZHBFEUWVZJNGIP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|