C18H21ClN6 — CID 69213443
5-(6-chloro-7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-2-(4-methylpiperazin-1-yl)aniline (PubChem CID 69213443) has the molecular formula C18H21ClN6 and a molecular weight of 356.86 g/mol. Its IUPAC name is 5-(6-chloro-7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-2-(4-methylpiperazin-1-yl)aniline.
| Compound Name | 5-(6-chloro-7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-2-(4-methylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 69213443 |
| Molecular Formula | C18H21ClN6 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 5-(6-chloro-7-methyl-1H-imidazo[4,5-b]pyridin-2-yl)-2-(4-methylpiperazin-1-yl)aniline |
| SMILES | Cc1c(Cl)cnc2nc(-c3ccc(N4CCN(C)CC4)c(N)c3)[nH]c12 |
| InChI | InChI=1S/C18H21ClN6/c1-11-13(19)10-21-18-16(11)22-17(23-18)12-3-4-15(14(20)9-12)25-7-5-24(2)6-8-25/h3-4,9-10H,5-8,20H2,1-2H3,(H,21,22,23) |
| InChIKey | ORJAOCKIDKOPHY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|