C28H28N4O4 — CID 46259401
1-[(2,5-dimethylphenyl)methyl]-4-[[4-(morpholine-4-carbonyl)phenyl]methyl]pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 46259401) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methyl]-4-[[4-(morpholine-4-carbonyl)phenyl]methyl]pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 1-[(2,5-dimethylphenyl)methyl]-4-[[4-(morpholine-4-carbonyl)phenyl]methyl]pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 46259401 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methyl]-4-[[4-(morpholine-4-carbonyl)phenyl]methyl]pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | Cc1ccc(C)c(Cn2c(=O)c(=O)n(Cc3ccc(C(=O)N4CCOCC4)cc3)c3ncccc32)c1 |
| InChI | InChI=1S/C28H28N4O4/c1-19-5-6-20(2)23(16-19)18-31-24-4-3-11-29-25(24)32(28(35)27(31)34)17-21-7-9-22(10-8-21)26(33)30-12-14-36-15-13-30/h3-11,16H,12-15,17-18H2,1-2H3 |
| InChIKey | YFCOBPDBGMYYGJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|