C30H31ClN4O — CID 167602492
1-[5-[5-chloro-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one (PubChem CID 167602492) has the molecular formula C30H31ClN4O and a molecular weight of 499.06 g/mol. Its IUPAC name is 1-[5-[5-chloro-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one.
| Compound Name | 1-[5-[5-chloro-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 167602492 |
| Molecular Formula | C30H31ClN4O |
| Molecular Weight | 499.06 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 1-[5-[5-chloro-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(Cl)c(C)c23)ccc1C |
| InChI | InChI=1S/C30H31ClN4O/c1-5-25(36)17-23-16-22(7-6-19(23)2)28-27-20(3)26(31)18-32-30(27)33-29(28)21-8-10-24(11-9-21)35-14-12-34(4)13-15-35/h5-11,16,18H,1,12-15,17H2,2-4H3,(H,32,33) |
| InChIKey | JXUBOVBRQRAOGA-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.06 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|