C33H36N4O3 — CID 167624094
propan-2-yl 3-[2-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 167624094) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is propan-2-yl 3-[2-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | propan-2-yl 3-[2-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 167624094 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | propan-2-yl 3-[2-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | C=CC(=O)Cc1cccc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(C(=O)OC(C)C)cc23)c1C |
| InChI | InChI=1S/C33H36N4O3/c1-6-27(38)18-24-8-7-9-28(22(24)4)30-29-19-25(33(39)40-21(2)3)20-34-32(29)35-31(30)23-10-12-26(13-11-23)37-16-14-36(5)15-17-37/h6-13,19-21H,1,14-18H2,2-5H3,(H,34,35) |
| InChIKey | MVPFVARZQODDRK-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|