C34H38N4O3 — CID 167675169
propan-2-yl 4-methyl-3-[4-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (PubChem CID 167675169) has the molecular formula C34H38N4O3 and a molecular weight of 550.70 g/mol. Its IUPAC name is propan-2-yl 4-methyl-3-[4-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate.
| Compound Name | propan-2-yl 4-methyl-3-[4-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 167675169 |
| Molecular Formula | C34H38N4O3 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | propan-2-yl 4-methyl-3-[4-methyl-3-(2-oxobut-3-enyl)phenyl]-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxylate |
| SMILES | C=CC(=O)Cc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(C(=O)OC(C)C)c(C)c23)ccc1C |
| InChI | InChI=1S/C34H38N4O3/c1-7-28(39)19-26-18-25(9-8-22(26)4)31-30-23(5)29(34(40)41-21(2)3)20-35-33(30)36-32(31)24-10-12-27(13-11-24)38-16-14-37(6)15-17-38/h7-13,18,20-21H,1,14-17,19H2,2-6H3,(H,35,36) |
| InChIKey | URXHHDIHEABDPD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|