C35H41N7O2 — CID 156833895
N-[5-[5-[(Z)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156833895) has the molecular formula C35H41N7O2 and a molecular weight of 591.76 g/mol. Its IUPAC name is N-[5-[5-[(Z)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[5-[(Z)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156833895 |
| Molecular Formula | C35H41N7O2 |
| Molecular Weight | 591.76 g/mol |
| Exact Mass | 591.33 |
| IUPAC Name | N-[5-[5-[(Z)-1-amino-3-(2-methoxyethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(C(=C/N)/C=N/CCOC)c(C)c23)ccc1C |
| InChI | InChI=1S/C35H41N7O2/c1-6-31(43)39-30-19-26(8-7-23(30)2)33-32-24(3)29(27(20-36)21-37-13-18-44-5)22-38-35(32)40-34(33)25-9-11-28(12-10-25)42-16-14-41(4)15-17-42/h6-12,19-22H,1,13-18,36H2,2-5H3,(H,38,40)(H,39,43)/b27-20+,37-21+ |
| InChIKey | AMQLFQAAHPNECP-JPBALWGDSA-N |
| XLogP | 5.41 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|