C34H39N7O2 — CID 156833863
N-[5-[5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156833863) has the molecular formula C34H39N7O2 and a molecular weight of 577.73 g/mol. Its IUPAC name is N-[5-[5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156833863 |
| Molecular Formula | C34H39N7O2 |
| Molecular Weight | 577.73 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | N-[5-[5-[(Z)-1-amino-3-ethyliminoprop-1-en-2-yl]-4-methoxy-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(C(=C/N)/C=N/CC)c(OC)c23)ccc1C |
| InChI | InChI=1S/C34H39N7O2/c1-6-29(42)38-28-18-24(9-8-22(28)3)30-31-33(43-5)27(25(19-35)20-36-7-2)21-37-34(31)39-32(30)23-10-12-26(13-11-23)41-16-14-40(4)15-17-41/h6,8-13,18-21H,1,7,14-17,35H2,2-5H3,(H,37,39)(H,38,42)/b25-19+,36-20+ |
| InChIKey | PGOOMYORZLEWCR-ZVGSBFRDSA-N |
| XLogP | 5.48 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.73 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|