C33H34F3N7O — CID 156833881
N-[5-[5-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156833881) has the molecular formula C33H34F3N7O and a molecular weight of 601.68 g/mol. Its IUPAC name is N-[5-[5-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[5-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156833881 |
| Molecular Formula | C33H34F3N7O |
| Molecular Weight | 601.68 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | N-[5-[5-[(Z,3E)-1-amino-3-(trifluoromethylimino)prop-1-en-2-yl]-4-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(C(=C/N)/C=N/C(F)(F)F)c(C)c23)ccc1C |
| InChI | InChI=1S/C33H34F3N7O/c1-5-28(44)40-27-16-23(7-6-20(27)2)30-29-21(3)26(24(17-37)18-39-33(34,35)36)19-38-32(29)41-31(30)22-8-10-25(11-9-22)43-14-12-42(4)13-15-43/h5-11,16-19H,1,12-15,37H2,2-4H3,(H,38,41)(H,40,44)/b24-17+,39-18+ |
| InChIKey | HCVJUTPWYIWCIH-IMZNTKGPSA-N |
| XLogP | 6.28 |
| TPSA | 102.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.68 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|