C35H39N7O — CID 156759676
N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156759676) has the molecular formula C35H39N7O and a molecular weight of 573.75 g/mol. Its IUPAC name is N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759676 |
| Molecular Formula | C35H39N7O |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 573.32 |
| IUPAC Name | N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(1-ethylpyrazol-4-yl)-4-methyl-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)[C@@H](C)C4)cc3)[nH]c3ncc(-c4cnn(CC)c4)c(C)c23)ccc1C |
| InChI | InChI=1S/C35H39N7O/c1-7-31(43)38-30-17-26(10-9-22(30)3)33-32-24(5)29(27-18-37-42(8-2)21-27)19-36-35(32)39-34(33)25-11-13-28(14-12-25)41-16-15-40(6)23(4)20-41/h7,9-14,17-19,21,23H,1,8,15-16,20H2,2-6H3,(H,36,39)(H,38,43)/t23-/m0/s1 |
| InChIKey | IATLMFSWZUUVGK-QHCPKHFHSA-N |
| XLogP | 6.66 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|