C33H35N7O — CID 156759756
N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(2-methylpyrazol-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide (PubChem CID 156759756) has the molecular formula C33H35N7O and a molecular weight of 545.69 g/mol. Its IUPAC name is N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(2-methylpyrazol-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide.
| Compound Name | N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(2-methylpyrazol-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759756 |
| Molecular Formula | C33H35N7O |
| Molecular Weight | 545.69 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | N-[5-[2-[4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]-5-(2-methylpyrazol-3-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]-2-methylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2c(-c3ccc(N4CCN(C)[C@@H](C)C4)cc3)[nH]c3ncc(-c4ccnn4C)cc23)ccc1C |
| InChI | InChI=1S/C33H35N7O/c1-6-30(41)36-28-18-24(8-7-21(28)2)31-27-17-25(29-13-14-35-39(29)5)19-34-33(27)37-32(31)23-9-11-26(12-10-23)40-16-15-38(4)22(3)20-40/h6-14,17-19,22H,1,15-16,20H2,2-5H3,(H,34,37)(H,36,41)/t22-/m0/s1 |
| InChIKey | SQKFOSZVZZTGRC-QFIPXVFZSA-N |
| XLogP | 5.87 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.69 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|