C34H37N7O — CID 156759646
N-[3-[5-(1,5-dimethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,6-dimethylphenyl]prop-2-enamide (PubChem CID 156759646) has the molecular formula C34H37N7O and a molecular weight of 559.72 g/mol. Its IUPAC name is N-[3-[5-(1,5-dimethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,6-dimethylphenyl]prop-2-enamide.
| Compound Name | N-[3-[5-(1,5-dimethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,6-dimethylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 156759646 |
| Molecular Formula | C34H37N7O |
| Molecular Weight | 559.72 g/mol |
| Exact Mass | 559.31 |
| IUPAC Name | N-[3-[5-(1,5-dimethylpyrazol-4-yl)-2-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-2,6-dimethylphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1c(C)ccc(-c2c(-c3ccc(N4CCN(C)CC4)cc3)[nH]c3ncc(-c4cnn(C)c4C)cc23)c1C |
| InChI | InChI=1S/C34H37N7O/c1-7-30(42)37-32-21(2)8-13-27(22(32)3)31-28-18-25(29-20-36-40(6)23(29)4)19-35-34(28)38-33(31)24-9-11-26(12-10-24)41-16-14-39(5)15-17-41/h7-13,18-20H,1,14-17H2,2-6H3,(H,35,38)(H,37,42) |
| InChIKey | RWVRAVJCEWHDGI-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.72 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|