C22H15ClN4 — CID 177349566
7-[4-(chloromethyl)phenyl]-6-phenyl-8H-imidazo[4,5-g]quinoxaline (PubChem CID 177349566) has the molecular formula C22H15ClN4 and a molecular weight of 370.84 g/mol. Its IUPAC name is 7-[4-(chloromethyl)phenyl]-6-phenyl-8H-imidazo[4,5-g]quinoxaline.
| Compound Name | 7-[4-(chloromethyl)phenyl]-6-phenyl-8H-imidazo[4,5-g]quinoxaline |
|---|---|
| PubChem CID | 177349566 |
| Molecular Formula | C22H15ClN4 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 7-[4-(chloromethyl)phenyl]-6-phenyl-8H-imidazo[4,5-g]quinoxaline |
| SMILES | ClCc1ccc(-c2[nH]c3cc4ncnc4cc3nc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H15ClN4/c23-12-14-6-8-16(9-7-14)22-21(15-4-2-1-3-5-15)26-19-10-17-18(25-13-24-17)11-20(19)27-22/h1-11,13,27H,12H2 |
| InChIKey | PIGLDDBVFOVAAL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|