C22H26N4O — CID 46390383
3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dimethyl-1H-quinoxalin-2-one (PubChem CID 46390383) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dimethyl-1H-quinoxalin-2-one.
| Compound Name | 3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dimethyl-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 46390383 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 3-[(4-benzylpiperazin-1-yl)methyl]-6,7-dimethyl-1H-quinoxalin-2-one |
| SMILES | Cc1cc2nc(CN3CCN(Cc4ccccc4)CC3)c(=O)[nH]c2cc1C |
| InChI | InChI=1S/C22H26N4O/c1-16-12-19-20(13-17(16)2)24-22(27)21(23-19)15-26-10-8-25(9-11-26)14-18-6-4-3-5-7-18/h3-7,12-13H,8-11,14-15H2,1-2H3,(H,24,27) |
| InChIKey | OVQDKKFDAIVPFU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |